C16H17FN4O5 — CID 19280431
1-[(5-fluoro-2-nitrophenoxy)methyl]-N-(oxolan-2-ylmethyl)pyrazole-3-carboxamide (PubChem CID 19280431) has the molecular formula C16H17FN4O5 and a molecular weight of 364.33 g/mol. Its IUPAC name is 1-[(5-fluoro-2-nitrophenoxy)methyl]-N-(oxolan-2-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 1-[(5-fluoro-2-nitrophenoxy)methyl]-N-(oxolan-2-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19280431 |
| Molecular Formula | C16H17FN4O5 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1-[(5-fluoro-2-nitrophenoxy)methyl]-N-(oxolan-2-ylmethyl)pyrazole-3-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1ccn(COc2cc(F)ccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C16H17FN4O5/c17-11-3-4-14(21(23)24)15(8-11)26-10-20-6-5-13(19-20)16(22)18-9-12-2-1-7-25-12/h3-6,8,12H,1-2,7,9-10H2,(H,18,22) |
| InChIKey | RKJMNPXWESORIC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|