C24H15F5N6O — CID 19286955
7-(4-methylphenyl)-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19286955) has the molecular formula C24H15F5N6O and a molecular weight of 498.42 g/mol. Its IUPAC name is 7-(4-methylphenyl)-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 7-(4-methylphenyl)-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 19286955 |
| Molecular Formula | C24H15F5N6O |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 7-(4-methylphenyl)-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1ccc(-c2ccnc3c(C(=O)Nc4ccn(Cc5c(F)c(F)c(F)c(F)c5F)n4)cnn23)cc1 |
| InChI | InChI=1S/C24H15F5N6O/c1-12-2-4-13(5-3-12)16-6-8-30-23-14(10-31-35(16)23)24(36)32-17-7-9-34(33-17)11-15-18(25)20(27)22(29)21(28)19(15)26/h2-10H,11H2,1H3,(H,32,33,36) |
| InChIKey | ZGEABOIEINQZSX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|