C26H31N3O3 — CID 19293671
(E)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[4-methoxy-3-[(2-methylphenoxy)methyl]phenyl]prop-2-enamide (PubChem CID 19293671) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is (E)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[4-methoxy-3-[(2-methylphenoxy)methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[4-methoxy-3-[(2-methylphenoxy)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 19293671 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | (E)-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[4-methoxy-3-[(2-methylphenoxy)methyl]phenyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCCCn2nc(C)cc2C)cc1COc1ccccc1C |
| InChI | InChI=1S/C26H31N3O3/c1-19-8-5-6-9-24(19)32-18-23-17-22(10-12-25(23)31-4)11-13-26(30)27-14-7-15-29-21(3)16-20(2)28-29/h5-6,8-13,16-17H,7,14-15,18H2,1-4H3,(H,27,30)/b13-11+ |
| InChIKey | VGHXACMTLNJYLY-ACCUITESSA-N |
| XLogP | 4.62 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|