C14H19ClN6O3 — CID 19296758
N-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide (PubChem CID 19296758) has the molecular formula C14H19ClN6O3 and a molecular weight of 354.80 g/mol. Its IUPAC name is N-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19296758 |
| Molecular Formula | C14H19ClN6O3 |
| Molecular Weight | 354.80 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide |
| SMILES | CCn1ncc(Cl)c1CNC(=O)CCn1nc(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C14H19ClN6O3/c1-4-19-12(11(15)7-17-19)8-16-13(22)5-6-20-10(3)14(21(23)24)9(2)18-20/h7H,4-6,8H2,1-3H3,(H,16,22) |
| InChIKey | RDYMDKZMCDHBKJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.80 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|