C19H18ClF4N3O — CID 19323965
(E)-N-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 19323965) has the molecular formula C19H18ClF4N3O and a molecular weight of 415.82 g/mol. Its IUPAC name is (E)-N-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19323965 |
| Molecular Formula | C19H18ClF4N3O |
| Molecular Weight | 415.82 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (E)-N-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)NCCCn1nc(C(F)(F)F)c(Cl)c1C1CC1 |
| InChI | InChI=1S/C19H18ClF4N3O/c20-16-17(13-5-6-13)27(26-18(16)19(22,23)24)11-1-10-25-15(28)9-4-12-2-7-14(21)8-3-12/h2-4,7-9,13H,1,5-6,10-11H2,(H,25,28)/b9-4+ |
| InChIKey | CWZNUMWRNRDYFM-RUDMXATFSA-N |
| XLogP | 4.79 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.82 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|