C16H22N4S — CID 19325073
1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-3-(4-ethylphenyl)thiourea (PubChem CID 19325073) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is 1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-3-(4-ethylphenyl)thiourea.
| Compound Name | 1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-3-(4-ethylphenyl)thiourea |
|---|---|
| PubChem CID | 19325073 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-3-(4-ethylphenyl)thiourea |
| SMILES | CCc1ccc(NC(=S)NCc2cnn(CC)c2C)cc1 |
| InChI | InChI=1S/C16H22N4S/c1-4-13-6-8-15(9-7-13)19-16(21)17-10-14-11-18-20(5-2)12(14)3/h6-9,11H,4-5,10H2,1-3H3,(H2,17,19,21) |
| InChIKey | MFYSSJRHHZHPDG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|