C30H30ClN5O4 — CID 19331678
[4-[(2-chloro-4-nitrophenoxy)methyl]phenyl]-[4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]methanone (PubChem CID 19331678) has the molecular formula C30H30ClN5O4 and a molecular weight of 560.05 g/mol. Its IUPAC name is [4-[(2-chloro-4-nitrophenoxy)methyl]phenyl]-[4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | [4-[(2-chloro-4-nitrophenoxy)methyl]phenyl]-[4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19331678 |
| Molecular Formula | C30H30ClN5O4 |
| Molecular Weight | 560.05 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | [4-[(2-chloro-4-nitrophenoxy)methyl]phenyl]-[4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]methanone |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CN1CCN(C(=O)c2ccc(COc3ccc([N+](=O)[O-])cc3Cl)cc2)CC1 |
| InChI | InChI=1S/C30H30ClN5O4/c1-21-27(22(2)35(32-21)25-6-4-3-5-7-25)19-33-14-16-34(17-15-33)30(37)24-10-8-23(9-11-24)20-40-29-13-12-26(36(38)39)18-28(29)31/h3-13,18H,14-17,19-20H2,1-2H3 |
| InChIKey | JKPKLXLMOYWMSB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 93.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.05 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|