C26H22ClN3O2 — CID 19335882
N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-2-(4-chlorobenzoyl)benzamide (PubChem CID 19335882) has the molecular formula C26H22ClN3O2 and a molecular weight of 443.93 g/mol. Its IUPAC name is N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-2-(4-chlorobenzoyl)benzamide.
| Compound Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-2-(4-chlorobenzoyl)benzamide |
|---|---|
| PubChem CID | 19335882 |
| Molecular Formula | C26H22ClN3O2 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-2-(4-chlorobenzoyl)benzamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1NC(=O)c1ccccc1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H22ClN3O2/c1-17-24(18(2)30(29-17)16-19-8-4-3-5-9-19)28-26(32)23-11-7-6-10-22(23)25(31)20-12-14-21(27)15-13-20/h3-15H,16H2,1-2H3,(H,28,32) |
| InChIKey | WSLZIYYJCBUXMV-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |