C7H18N2O3 — CID 19354209
7-amino-1,2-dihydroxyheptan-4-one;azane (PubChem CID 19354209) has the molecular formula C7H18N2O3 and a molecular weight of 178.23 g/mol. Its IUPAC name is 7-amino-1,2-dihydroxyheptan-4-one;azane.
| Compound Name | 7-amino-1,2-dihydroxyheptan-4-one;azane |
|---|---|
| PubChem CID | 19354209 |
| Molecular Formula | C7H18N2O3 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.13 |
| IUPAC Name | 7-amino-1,2-dihydroxyheptan-4-one;azane |
| SMILES | N.NCCCC(=O)CC(O)CO |
| InChI | InChI=1S/C7H15NO3.H3N/c8-3-1-2-6(10)4-7(11)5-9;/h7,9,11H,1-5,8H2;1H3 |
| InChIKey | RVFUMGDWADSYAA-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 118.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |