C12H12O5S2 — CID 19354741
methyl 6-ethyl-1,1,3-trioxo-1λ6,4-benzodithiine-7-carboxylate (PubChem CID 19354741) has the molecular formula C12H12O5S2 and a molecular weight of 300.36 g/mol. Its IUPAC name is methyl 6-ethyl-1,1,3-trioxo-1λ6,4-benzodithiine-7-carboxylate.
| Compound Name | methyl 6-ethyl-1,1,3-trioxo-1λ6,4-benzodithiine-7-carboxylate |
|---|---|
| PubChem CID | 19354741 |
| Molecular Formula | C12H12O5S2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | methyl 6-ethyl-1,1,3-trioxo-1λ6,4-benzodithiine-7-carboxylate |
| SMILES | CCc1cc2c(cc1C(=O)OC)S(=O)(=O)CC(=O)S2 |
| InChI | InChI=1S/C12H12O5S2/c1-3-7-4-9-10(5-8(7)12(14)17-2)19(15,16)6-11(13)18-9/h4-5H,3,6H2,1-2H3 |
| InChIKey | JIBWXZKOYOAKAE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|