About methyl 6-ethyl-3,4-dihydro-2H-1,4-benzothiazine-7-carboxylate
methyl 6-ethyl-3,4-dihydro-2H-1,4-benzothiazine-7-carboxylate (PubChem CID 140990900) has the molecular formula C12H15NO2S
and a molecular weight of 237.32 g/mol. Its IUPAC name is methyl 6-ethyl-3,4-dihydro-2H-1,4-benzothiazine-7-carboxylate.
Analyze methyl 6-ethyl-3,4-dihydro-2H-1,4-benzothiazine-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-ethyl-3,4-dihydro-2H-1,4-benzothiazine-7-carboxylate?
The IUPAC name of methyl 6-ethyl-3,4-dihydro-2H-1,4-benzothiazine-7-carboxylate (CID 140990900) is methyl 6-ethyl-3,4-dihydro-2H-1,4-benzothiazine-7-carboxylate.
What is the SMILES notation for methyl 6-ethyl-3,4-dihydro-2H-1,4-benzothiazine-7-carboxylate?
The canonical SMILES for methyl 6-ethyl-3,4-dihydro-2H-1,4-benzothiazine-7-carboxylate is CCc1cc2c(cc1C(=O)OC)SCCN2.
What is the InChIKey of methyl 6-ethyl-3,4-dihydro-2H-1,4-benzothiazine-7-carboxylate?
The InChIKey is RNOQLUAIEIKDPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2S/c1-3-8-6-10-11(16-5-4-13-10)7-9(8)12(14)15-2/h6-7,13H,3-5H2,1-2H3.
What are the key properties of methyl 6-ethyl-3,4-dihydro-2H-1,4-benzothiazine-7-carboxylate?
methyl 6-ethyl-3,4-dihydro-2H-1,4-benzothiazine-7-carboxylate has a molecular weight of 237.32 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-ethyl-3,4-dihydro-2H-1,4-benzothiazine-7-carboxylate is sourced from PubChem (CID 140990900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).