C16H14F2N4O2S — CID 19355755
4-[5-(difluoromethyl)-1-methyl-3-pyridin-4-ylpyrazol-4-yl]benzenesulfonamide (PubChem CID 19355755) has the molecular formula C16H14F2N4O2S and a molecular weight of 364.38 g/mol. Its IUPAC name is 4-[5-(difluoromethyl)-1-methyl-3-pyridin-4-ylpyrazol-4-yl]benzenesulfonamide.
| Compound Name | 4-[5-(difluoromethyl)-1-methyl-3-pyridin-4-ylpyrazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 19355755 |
| Molecular Formula | C16H14F2N4O2S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 4-[5-(difluoromethyl)-1-methyl-3-pyridin-4-ylpyrazol-4-yl]benzenesulfonamide |
| SMILES | Cn1nc(-c2ccncc2)c(-c2ccc(S(N)(=O)=O)cc2)c1C(F)F |
| InChI | InChI=1S/C16H14F2N4O2S/c1-22-15(16(17)18)13(14(21-22)11-6-8-20-9-7-11)10-2-4-12(5-3-10)25(19,23)24/h2-9,16H,1H3,(H2,19,23,24) |
| InChIKey | RJXKWCOQMFLHOM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |