C19H16ClN3O2S — CID 19355970
2-[4-(4-chlorophenyl)-5-methyl-3-(4-methylsulfonylphenyl)pyrazol-1-yl]acetonitrile (PubChem CID 19355970) has the molecular formula C19H16ClN3O2S and a molecular weight of 385.88 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-5-methyl-3-(4-methylsulfonylphenyl)pyrazol-1-yl]acetonitrile.
| Compound Name | 2-[4-(4-chlorophenyl)-5-methyl-3-(4-methylsulfonylphenyl)pyrazol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 19355970 |
| Molecular Formula | C19H16ClN3O2S |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-5-methyl-3-(4-methylsulfonylphenyl)pyrazol-1-yl]acetonitrile |
| SMILES | Cc1c(-c2ccc(Cl)cc2)c(-c2ccc(S(C)(=O)=O)cc2)nn1CC#N |
| InChI | InChI=1S/C19H16ClN3O2S/c1-13-18(14-3-7-16(20)8-4-14)19(22-23(13)12-11-21)15-5-9-17(10-6-15)26(2,24)25/h3-10H,12H2,1-2H3 |
| InChIKey | ZIWKTPYYNTTZIH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |