C19H15ClN4O2S — CID 54228884
4-[4-(4-chlorophenyl)-5-cyano-1-prop-2-enylpyrazol-3-yl]benzenesulfonamide (PubChem CID 54228884) has the molecular formula C19H15ClN4O2S and a molecular weight of 398.88 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-5-cyano-1-prop-2-enylpyrazol-3-yl]benzenesulfonamide.
| Compound Name | 4-[4-(4-chlorophenyl)-5-cyano-1-prop-2-enylpyrazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 54228884 |
| Molecular Formula | C19H15ClN4O2S |
| Molecular Weight | 398.88 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-5-cyano-1-prop-2-enylpyrazol-3-yl]benzenesulfonamide |
| SMILES | C=CCn1nc(-c2ccc(S(N)(=O)=O)cc2)c(-c2ccc(Cl)cc2)c1C#N |
| InChI | InChI=1S/C19H15ClN4O2S/c1-2-11-24-17(12-21)18(13-3-7-15(20)8-4-13)19(23-24)14-5-9-16(10-6-14)27(22,25)26/h2-10H,1,11H2,(H2,22,25,26) |
| InChIKey | QHUPFLLIKFWBIF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.88 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|