C24H19ClN3O4S- — CID 18914556
4-(4-chlorophenyl)-1-(2-phenylethyl)-3-(4-sulfamoylphenyl)pyrazole-5-carboxylate (PubChem CID 18914556) has the molecular formula C24H19ClN3O4S- and a molecular weight of 480.95 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-(2-phenylethyl)-3-(4-sulfamoylphenyl)pyrazole-5-carboxylate.
| Compound Name | 4-(4-chlorophenyl)-1-(2-phenylethyl)-3-(4-sulfamoylphenyl)pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 18914556 |
| Molecular Formula | C24H19ClN3O4S- |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 4-(4-chlorophenyl)-1-(2-phenylethyl)-3-(4-sulfamoylphenyl)pyrazole-5-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(-c2nn(CCc3ccccc3)c(C(=O)[O-])c2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H20ClN3O4S/c25-19-10-6-17(7-11-19)21-22(18-8-12-20(13-9-18)33(26,31)32)27-28(23(21)24(29)30)15-14-16-4-2-1-3-5-16/h1-13H,14-15H2,(H,29,30)(H2,26,31,32)/p-1 |
| InChIKey | VFUMTMFDMLPSCS-UHFFFAOYSA-M |
| XLogP | 3.12 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |