C30H26N4O3S — CID 19355610
1-benzyl-4-(4-methylphenyl)-N-phenyl-3-(4-sulfamoylphenyl)pyrazole-5-carboxamide (PubChem CID 19355610) has the molecular formula C30H26N4O3S and a molecular weight of 522.63 g/mol. Its IUPAC name is 1-benzyl-4-(4-methylphenyl)-N-phenyl-3-(4-sulfamoylphenyl)pyrazole-5-carboxamide.
| Compound Name | 1-benzyl-4-(4-methylphenyl)-N-phenyl-3-(4-sulfamoylphenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19355610 |
| Molecular Formula | C30H26N4O3S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 1-benzyl-4-(4-methylphenyl)-N-phenyl-3-(4-sulfamoylphenyl)pyrazole-5-carboxamide |
| SMILES | Cc1ccc(-c2c(-c3ccc(S(N)(=O)=O)cc3)nn(Cc3ccccc3)c2C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C30H26N4O3S/c1-21-12-14-23(15-13-21)27-28(24-16-18-26(19-17-24)38(31,36)37)33-34(20-22-8-4-2-5-9-22)29(27)30(35)32-25-10-6-3-7-11-25/h2-19H,20H2,1H3,(H,32,35)(H2,31,36,37) |
| InChIKey | QYWCDMMIERLGMZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |