C19H19F2N3O2S — CID 19355591
4-[5-(difluoromethyl)-1-ethyl-4-(4-methylphenyl)pyrazol-3-yl]benzenesulfonamide (PubChem CID 19355591) has the molecular formula C19H19F2N3O2S and a molecular weight of 391.44 g/mol. Its IUPAC name is 4-[5-(difluoromethyl)-1-ethyl-4-(4-methylphenyl)pyrazol-3-yl]benzenesulfonamide.
| Compound Name | 4-[5-(difluoromethyl)-1-ethyl-4-(4-methylphenyl)pyrazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 19355591 |
| Molecular Formula | C19H19F2N3O2S |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 4-[5-(difluoromethyl)-1-ethyl-4-(4-methylphenyl)pyrazol-3-yl]benzenesulfonamide |
| SMILES | CCn1nc(-c2ccc(S(N)(=O)=O)cc2)c(-c2ccc(C)cc2)c1C(F)F |
| InChI | InChI=1S/C19H19F2N3O2S/c1-3-24-18(19(20)21)16(13-6-4-12(2)5-7-13)17(23-24)14-8-10-15(11-9-14)27(22,25)26/h4-11,19H,3H2,1-2H3,(H2,22,25,26) |
| InChIKey | YZROXVOQSQYJII-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |