C21H18F5N3O2S — CID 173275789
4-[4-(4-methylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1-prop-1-enylpyrazol-3-yl]benzenesulfonamide (PubChem CID 173275789) has the molecular formula C21H18F5N3O2S and a molecular weight of 471.45 g/mol. Its IUPAC name is 4-[4-(4-methylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1-prop-1-enylpyrazol-3-yl]benzenesulfonamide.
| Compound Name | 4-[4-(4-methylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1-prop-1-enylpyrazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 173275789 |
| Molecular Formula | C21H18F5N3O2S |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 4-[4-(4-methylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-1-prop-1-enylpyrazol-3-yl]benzenesulfonamide |
| SMILES | CC=Cn1nc(-c2ccc(S(N)(=O)=O)cc2)c(-c2ccc(C)cc2)c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H18F5N3O2S/c1-3-12-29-19(20(22,23)21(24,25)26)17(14-6-4-13(2)5-7-14)18(28-29)15-8-10-16(11-9-15)32(27,30)31/h3-12H,1-2H3,(H2,27,30,31) |
| InChIKey | ASBKLVPZTXPMCS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|