C19H21F2N3O2 — CID 19357132
4-(3,5-difluorophenyl)-N-(2-hydroxy-4,5-dimethylphenyl)piperazine-1-carboxamide (PubChem CID 19357132) has the molecular formula C19H21F2N3O2 and a molecular weight of 361.39 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-N-(2-hydroxy-4,5-dimethylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(3,5-difluorophenyl)-N-(2-hydroxy-4,5-dimethylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 19357132 |
| Molecular Formula | C19H21F2N3O2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 4-(3,5-difluorophenyl)-N-(2-hydroxy-4,5-dimethylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1cc(O)c(NC(=O)N2CCN(c3cc(F)cc(F)c3)CC2)cc1C |
| InChI | InChI=1S/C19H21F2N3O2/c1-12-7-17(18(25)8-13(12)2)22-19(26)24-5-3-23(4-6-24)16-10-14(20)9-15(21)11-16/h7-11,25H,3-6H2,1-2H3,(H,22,26) |
| InChIKey | UXTPIIBYBGXYTC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|