About 4-[2-(diethylamino)ethylamino]-9-ethyl-7-methyl-5H-imidazo[5,1-h]pteridin-6-one
4-[2-(diethylamino)ethylamino]-9-ethyl-7-methyl-5H-imidazo[5,1-h]pteridin-6-one (PubChem CID 19358863) has the molecular formula C17H25N7O
and a molecular weight of 343.44 g/mol. Its IUPAC name is 4-[2-(diethylamino)ethylamino]-9-ethyl-7-methyl-5H-imidazo[5,1-h]pteridin-6-one.
Molecular Properties
| Compound Name | 4-[2-(diethylamino)ethylamino]-9-ethyl-7-methyl-5H-imidazo[5,1-h]pteridin-6-one |
| PubChem CID | 19358863 |
| Molecular Formula | C17H25N7O |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 4-[2-(diethylamino)ethylamino]-9-ethyl-7-methyl-5H-imidazo[5,1-h]pteridin-6-one |
| SMILES | CCc1nc(C)c2c(=O)[nH]c3c(NCCN(CC)CC)ncnc3n12 |
| InChI | InChI=1S/C17H25N7O/c1-5-12-21-11(4)14-17(25)22-13-15(18-8-9-23(6-2)7-3)19-10-20-16(13)24(12)14/h10H,5-9H2,1-4H3,(H,22,25)(H,18,19,20) |
| InChIKey | OIHUCHJCRYACFK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[2-(diethylamino)ethylamino]-9-ethyl-7-methyl-5H-imidazo[5,1-h]pteridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(diethylamino)ethylamino]-9-ethyl-7-methyl-5H-imidazo[5,1-h]pteridin-6-one?
The IUPAC name of 4-[2-(diethylamino)ethylamino]-9-ethyl-7-methyl-5H-imidazo[5,1-h]pteridin-6-one (CID 19358863) is 4-[2-(diethylamino)ethylamino]-9-ethyl-7-methyl-5H-imidazo[5,1-h]pteridin-6-one.
What is the SMILES notation for 4-[2-(diethylamino)ethylamino]-9-ethyl-7-methyl-5H-imidazo[5,1-h]pteridin-6-one?
The canonical SMILES for 4-[2-(diethylamino)ethylamino]-9-ethyl-7-methyl-5H-imidazo[5,1-h]pteridin-6-one is CCc1nc(C)c2c(=O)[nH]c3c(NCCN(CC)CC)ncnc3n12.
What is the InChIKey of 4-[2-(diethylamino)ethylamino]-9-ethyl-7-methyl-5H-imidazo[5,1-h]pteridin-6-one?
The InChIKey is OIHUCHJCRYACFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N7O/c1-5-12-21-11(4)14-17(25)22-13-15(18-8-9-23(6-2)7-3)19-10-20-16(13)24(12)14/h10H,5-9H2,1-4H3,(H,22,25)(H,18,19,20).
What are the key properties of 4-[2-(diethylamino)ethylamino]-9-ethyl-7-methyl-5H-imidazo[5,1-h]pteridin-6-one?
4-[2-(diethylamino)ethylamino]-9-ethyl-7-methyl-5H-imidazo[5,1-h]pteridin-6-one has a molecular weight of 343.44 g/mol, XLogP of 1.59, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(diethylamino)ethylamino]-9-ethyl-7-methyl-5H-imidazo[5,1-h]pteridin-6-one is sourced from PubChem (CID 19358863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).