About 4-aminobutyl(ethyl)tin(2+);methanolate
4-aminobutyl(ethyl)tin(2+);methanolate (PubChem CID 19359545) has the molecular formula C8H21NO2Sn
and a molecular weight of 281.97 g/mol. Its IUPAC name is 4-aminobutyl(ethyl)tin(2+);methanolate.
Molecular Properties
| Compound Name | 4-aminobutyl(ethyl)tin(2+);methanolate |
| PubChem CID | 19359545 |
| Molecular Formula | C8H21NO2Sn |
| Molecular Weight | 281.97 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 4-aminobutyl(ethyl)tin(2+);methanolate |
| SMILES | CC[Sn+2]CCCCN.C[O-].C[O-] |
| InChI | InChI=1S/C4H10N.C2H5.2CH3O.Sn/c1-2-3-4-5;3*1-2;/h1-5H2;1H2,2H3;2*1H3;/q;;2*-1;+2 |
| InChIKey | HPUCFBXANOZQJC-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.97 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobutyl(ethyl)tin(2+);methanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobutyl(ethyl)tin(2+);methanolate?
The IUPAC name of 4-aminobutyl(ethyl)tin(2+);methanolate (CID 19359545) is 4-aminobutyl(ethyl)tin(2+);methanolate.
What is the SMILES notation for 4-aminobutyl(ethyl)tin(2+);methanolate?
The canonical SMILES for 4-aminobutyl(ethyl)tin(2+);methanolate is CC[Sn+2]CCCCN.C[O-].C[O-].
What is the InChIKey of 4-aminobutyl(ethyl)tin(2+);methanolate?
The InChIKey is HPUCFBXANOZQJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N.C2H5.2CH3O.Sn/c1-2-3-4-5;3*1-2;/h1-5H2;1H2,2H3;2*1H3;/q;;2*-1;+2.
What are the key properties of 4-aminobutyl(ethyl)tin(2+);methanolate?
4-aminobutyl(ethyl)tin(2+);methanolate has a molecular weight of 281.97 g/mol, XLogP of -0.76, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobutyl(ethyl)tin(2+);methanolate is sourced from PubChem (CID 19359545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).