About 4-aminobutyl(ethyl)tin(2+);bis(butan-2-olate)
4-aminobutyl(ethyl)tin(2+);bis(butan-2-olate) (PubChem CID 19359690) has the molecular formula C14H33NO2Sn
and a molecular weight of 366.13 g/mol. Its IUPAC name is 4-aminobutyl(ethyl)tin(2+);bis(butan-2-olate).
Molecular Properties
| Compound Name | 4-aminobutyl(ethyl)tin(2+);bis(butan-2-olate) |
| PubChem CID | 19359690 |
| Molecular Formula | C14H33NO2Sn |
| Molecular Weight | 366.13 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 4-aminobutyl(ethyl)tin(2+);bis(butan-2-olate) |
| SMILES | CCC(C)[O-].CCC(C)[O-].CC[Sn+2]CCCCN |
| InChI | InChI=1S/C4H10N.2C4H9O.C2H5.Sn/c1-2-3-4-5;2*1-3-4(2)5;1-2;/h1-5H2;2*4H,3H2,1-2H3;1H2,2H3;/q;2*-1;;+2 |
| InChIKey | WFRWSAWNBZQTSE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.13 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobutyl(ethyl)tin(2+);bis(butan-2-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobutyl(ethyl)tin(2+);bis(butan-2-olate)?
The IUPAC name of 4-aminobutyl(ethyl)tin(2+);bis(butan-2-olate) (CID 19359690) is 4-aminobutyl(ethyl)tin(2+);bis(butan-2-olate).
What is the SMILES notation for 4-aminobutyl(ethyl)tin(2+);bis(butan-2-olate)?
The canonical SMILES for 4-aminobutyl(ethyl)tin(2+);bis(butan-2-olate) is CCC(C)[O-].CCC(C)[O-].CC[Sn+2]CCCCN.
What is the InChIKey of 4-aminobutyl(ethyl)tin(2+);bis(butan-2-olate)?
The InChIKey is WFRWSAWNBZQTSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N.2C4H9O.C2H5.Sn/c1-2-3-4-5;2*1-3-4(2)5;1-2;/h1-5H2;2*4H,3H2,1-2H3;1H2,2H3;/q;2*-1;;+2.
What are the key properties of 4-aminobutyl(ethyl)tin(2+);bis(butan-2-olate)?
4-aminobutyl(ethyl)tin(2+);bis(butan-2-olate) has a molecular weight of 366.13 g/mol, XLogP of 1.58, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobutyl(ethyl)tin(2+);bis(butan-2-olate) is sourced from PubChem (CID 19359690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).