C11H12N2O2S2 — CID 19364528
4-(1,3-benzothiazol-2-yl)-2-hydroxysulfanylmorpholine (PubChem CID 19364528) has the molecular formula C11H12N2O2S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-2-hydroxysulfanylmorpholine.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-2-hydroxysulfanylmorpholine |
|---|---|
| PubChem CID | 19364528 |
| Molecular Formula | C11H12N2O2S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-2-hydroxysulfanylmorpholine |
| SMILES | OSC1CN(c2nc3ccccc3s2)CCO1 |
| InChI | InChI=1S/C11H12N2O2S2/c14-17-10-7-13(5-6-15-10)11-12-8-3-1-2-4-9(8)16-11/h1-4,10,14H,5-7H2 |
| InChIKey | SWLDBVYFQAXINA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|