C18H18N2O2S — CID 75536962
(6R)-4-(1,3-benzothiazol-2-yl)-6-phenoxy-1,4-oxazepane (PubChem CID 75536962) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is (6R)-4-(1,3-benzothiazol-2-yl)-6-phenoxy-1,4-oxazepane.
| Compound Name | (6R)-4-(1,3-benzothiazol-2-yl)-6-phenoxy-1,4-oxazepane |
|---|---|
| PubChem CID | 75536962 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (6R)-4-(1,3-benzothiazol-2-yl)-6-phenoxy-1,4-oxazepane |
| SMILES | c1ccc(O[C@H]2COCCN(c3nc4ccccc4s3)C2)cc1 |
| InChI | InChI=1S/C18H18N2O2S/c1-2-6-14(7-3-1)22-15-12-20(10-11-21-13-15)18-19-16-8-4-5-9-17(16)23-18/h1-9,15H,10-13H2/t15-/m1/s1 |
| InChIKey | UQVMFGXCXWSWGY-OAHLLOKOSA-N |
| XLogP | 3.58 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |