C16H23NO3 — CID 19373360
4-butyl-1-hex-5-ynyl-2,6,7-trioxabicyclo[2.2.2]octane-3-carbonitrile (PubChem CID 19373360) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 4-butyl-1-hex-5-ynyl-2,6,7-trioxabicyclo[2.2.2]octane-3-carbonitrile.
| Compound Name | 4-butyl-1-hex-5-ynyl-2,6,7-trioxabicyclo[2.2.2]octane-3-carbonitrile |
|---|---|
| PubChem CID | 19373360 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 4-butyl-1-hex-5-ynyl-2,6,7-trioxabicyclo[2.2.2]octane-3-carbonitrile |
| SMILES | C#CCCCCC12OCC(CCCC)(CO1)C(C#N)O2 |
| InChI | InChI=1S/C16H23NO3/c1-3-5-7-8-10-16-18-12-15(13-19-16,9-6-4-2)14(11-17)20-16/h1,14H,4-10,12-13H2,2H3 |
| InChIKey | WFQORVBQMUVSNE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|