C8H15N3S — CID 19375427
1,4,5-triethyl-1,2,4-triazol-4-ium-3-thiolate (PubChem CID 19375427) has the molecular formula C8H15N3S and a molecular weight of 185.30 g/mol. Its IUPAC name is 1,4,5-triethyl-1,2,4-triazol-4-ium-3-thiolate.
| Compound Name | 1,4,5-triethyl-1,2,4-triazol-4-ium-3-thiolate |
|---|---|
| PubChem CID | 19375427 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 1,4,5-triethyl-1,2,4-triazol-4-ium-3-thiolate |
| SMILES | CCc1n(CC)nc([S-])[n+]1CC |
| InChI | InChI=1S/C8H15N3S/c1-4-7-10(5-2)8(12)9-11(7)6-3/h4-6H2,1-3H3 |
| InChIKey | SOHUVRKFDGRJIV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|