C8H17N3 — CID 19375518
1,5,9-triazaspiro[5.5]undecane (PubChem CID 19375518) has the molecular formula C8H17N3 and a molecular weight of 155.24 g/mol. Its IUPAC name is 1,5,9-triazaspiro[5.5]undecane.
| Compound Name | 1,5,9-triazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 19375518 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 1,5,9-triazaspiro[5.5]undecane |
| SMILES | C1CNC2(CCNCC2)NC1 |
| InChI | InChI=1S/C8H17N3/c1-4-10-8(11-5-1)2-6-9-7-3-8/h9-11H,1-7H2 |
| InChIKey | JCXAZVNIXWPSMY-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |