C13H19NO4S — CID 19376808
2-O-amino 4-O-ethyl 3-tert-butyl-5-methylthiophene-2,4-dicarboxylate (PubChem CID 19376808) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-O-amino 4-O-ethyl 3-tert-butyl-5-methylthiophene-2,4-dicarboxylate.
| Compound Name | 2-O-amino 4-O-ethyl 3-tert-butyl-5-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19376808 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-O-amino 4-O-ethyl 3-tert-butyl-5-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)sc(C(=O)ON)c1C(C)(C)C |
| InChI | InChI=1S/C13H19NO4S/c1-6-17-11(15)8-7(2)19-10(12(16)18-14)9(8)13(3,4)5/h6,14H2,1-5H3 |
| InChIKey | KTWWNDDPZHQKJP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|