C16H24O5S — CID 57178038
3-tert-butyl-5-ethoxycarbonyl-4-[(2-methylpropan-2-yl)oxy]thiophene-2-carboxylic acid (PubChem CID 57178038) has the molecular formula C16H24O5S and a molecular weight of 328.43 g/mol. Its IUPAC name is 3-tert-butyl-5-ethoxycarbonyl-4-[(2-methylpropan-2-yl)oxy]thiophene-2-carboxylic acid.
| Compound Name | 3-tert-butyl-5-ethoxycarbonyl-4-[(2-methylpropan-2-yl)oxy]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 57178038 |
| Molecular Formula | C16H24O5S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 3-tert-butyl-5-ethoxycarbonyl-4-[(2-methylpropan-2-yl)oxy]thiophene-2-carboxylic acid |
| SMILES | CCOC(=O)c1sc(C(=O)O)c(C(C)(C)C)c1OC(C)(C)C |
| InChI | InChI=1S/C16H24O5S/c1-8-20-14(19)12-10(21-16(5,6)7)9(15(2,3)4)11(22-12)13(17)18/h8H2,1-7H3,(H,17,18) |
| InChIKey | AZRREDDQEMLKRY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |