C25H44N2O4 — CID 19377274
1,3-bis(hydroxymethyl)-5,5-bis(5-methyl-2-propan-2-ylcyclohexyl)imidazolidine-2,4-dione (PubChem CID 19377274) has the molecular formula C25H44N2O4 and a molecular weight of 436.64 g/mol. Its IUPAC name is 1,3-bis(hydroxymethyl)-5,5-bis(5-methyl-2-propan-2-ylcyclohexyl)imidazolidine-2,4-dione.
| Compound Name | 1,3-bis(hydroxymethyl)-5,5-bis(5-methyl-2-propan-2-ylcyclohexyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 19377274 |
| Molecular Formula | C25H44N2O4 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | 1,3-bis(hydroxymethyl)-5,5-bis(5-methyl-2-propan-2-ylcyclohexyl)imidazolidine-2,4-dione |
| SMILES | CC1CCC(C(C)C)C(C2(C3CC(C)CCC3C(C)C)C(=O)N(CO)C(=O)N2CO)C1 |
| InChI | InChI=1S/C25H44N2O4/c1-15(2)19-9-7-17(5)11-21(19)25(22-12-18(6)8-10-20(22)16(3)4)23(30)26(13-28)24(31)27(25)14-29/h15-22,28-29H,7-14H2,1-6H3 |
| InChIKey | HXRVOPYQXABCBE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|