C15H25NO3 — CID 173101252
2-(5-methyl-2-propan-2-ylcyclohexyl)-5-oxooxolane-2-carboxamide (PubChem CID 173101252) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 2-(5-methyl-2-propan-2-ylcyclohexyl)-5-oxooxolane-2-carboxamide.
| Compound Name | 2-(5-methyl-2-propan-2-ylcyclohexyl)-5-oxooxolane-2-carboxamide |
|---|---|
| PubChem CID | 173101252 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 2-(5-methyl-2-propan-2-ylcyclohexyl)-5-oxooxolane-2-carboxamide |
| SMILES | CC1CCC(C(C)C)C(C2(C(N)=O)CCC(=O)O2)C1 |
| InChI | InChI=1S/C15H25NO3/c1-9(2)11-5-4-10(3)8-12(11)15(14(16)18)7-6-13(17)19-15/h9-12H,4-8H2,1-3H3,(H2,16,18) |
| InChIKey | IWQGHTFCBGRGTG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |