About methyl N-[[6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methyl]carbamate
methyl N-[[6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methyl]carbamate (PubChem CID 19387110) has the molecular formula C19H21N3O4
and a molecular weight of 355.39 g/mol. Its IUPAC name is methyl N-[[6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[[6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methyl]carbamate |
| PubChem CID | 19387110 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | methyl N-[[6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methyl]carbamate |
| SMILES | COC(=O)NCC1=C(N2CCCC2=O)c2cc(C#N)ccc2OC1(C)C |
| InChI | InChI=1S/C19H21N3O4/c1-19(2)14(11-21-18(24)25-3)17(22-8-4-5-16(22)23)13-9-12(10-20)6-7-15(13)26-19/h6-7,9H,4-5,8,11H2,1-3H3,(H,21,24) |
| InChIKey | HXULZUVBUVANPY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl N-[[6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[[6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methyl]carbamate?
The IUPAC name of methyl N-[[6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methyl]carbamate (CID 19387110) is methyl N-[[6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methyl]carbamate.
What is the SMILES notation for methyl N-[[6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methyl]carbamate?
The canonical SMILES for methyl N-[[6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methyl]carbamate is COC(=O)NCC1=C(N2CCCC2=O)c2cc(C#N)ccc2OC1(C)C.
What is the InChIKey of methyl N-[[6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methyl]carbamate?
The InChIKey is HXULZUVBUVANPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O4/c1-19(2)14(11-21-18(24)25-3)17(22-8-4-5-16(22)23)13-9-12(10-20)6-7-15(13)26-19/h6-7,9H,4-5,8,11H2,1-3H3,(H,21,24).
What are the key properties of methyl N-[[6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methyl]carbamate?
methyl N-[[6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methyl]carbamate has a molecular weight of 355.39 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[[6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methyl]carbamate is sourced from PubChem (CID 19387110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).