C18H21F3N2O3 — CID 19387153
1-[3-[(methoxyamino)methyl]-2,2-dimethyl-6-(trifluoromethyl)chromen-4-yl]pyrrolidin-2-one (PubChem CID 19387153) has the molecular formula C18H21F3N2O3 and a molecular weight of 370.37 g/mol. Its IUPAC name is 1-[3-[(methoxyamino)methyl]-2,2-dimethyl-6-(trifluoromethyl)chromen-4-yl]pyrrolidin-2-one.
| Compound Name | 1-[3-[(methoxyamino)methyl]-2,2-dimethyl-6-(trifluoromethyl)chromen-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 19387153 |
| Molecular Formula | C18H21F3N2O3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1-[3-[(methoxyamino)methyl]-2,2-dimethyl-6-(trifluoromethyl)chromen-4-yl]pyrrolidin-2-one |
| SMILES | CONCC1=C(N2CCCC2=O)c2cc(C(F)(F)F)ccc2OC1(C)C |
| InChI | InChI=1S/C18H21F3N2O3/c1-17(2)13(10-22-25-3)16(23-8-4-5-15(23)24)12-9-11(18(19,20)21)6-7-14(12)26-17/h6-7,9,22H,4-5,8,10H2,1-3H3 |
| InChIKey | GWUMRNRASGWQEJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|