C21H19F3N2O3 — CID 139615129
2-[3-(methoxyamino)-2,2-dimethyl-6-(trifluoromethyl)chromen-4-yl]-3H-isoindol-1-one (PubChem CID 139615129) has the molecular formula C21H19F3N2O3 and a molecular weight of 404.39 g/mol. Its IUPAC name is 2-[3-(methoxyamino)-2,2-dimethyl-6-(trifluoromethyl)chromen-4-yl]-3H-isoindol-1-one.
| Compound Name | 2-[3-(methoxyamino)-2,2-dimethyl-6-(trifluoromethyl)chromen-4-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 139615129 |
| Molecular Formula | C21H19F3N2O3 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-[3-(methoxyamino)-2,2-dimethyl-6-(trifluoromethyl)chromen-4-yl]-3H-isoindol-1-one |
| SMILES | CONC1=C(N2Cc3ccccc3C2=O)c2cc(C(F)(F)F)ccc2OC1(C)C |
| InChI | InChI=1S/C21H19F3N2O3/c1-20(2)18(25-28-3)17(26-11-12-6-4-5-7-14(12)19(26)27)15-10-13(21(22,23)24)8-9-16(15)29-20/h4-10,25H,11H2,1-3H3 |
| InChIKey | XKZZDUXPMVUMDW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|