C23H21F3N2O4 — CID 19387257
N-[[2,2-dimethyl-4-(3-oxo-1H-isoindol-2-yl)-6-(trifluoromethyl)chromen-3-yl]methyl]-N-methoxyformamide (PubChem CID 19387257) has the molecular formula C23H21F3N2O4 and a molecular weight of 446.43 g/mol. Its IUPAC name is N-[[2,2-dimethyl-4-(3-oxo-1H-isoindol-2-yl)-6-(trifluoromethyl)chromen-3-yl]methyl]-N-methoxyformamide.
| Compound Name | N-[[2,2-dimethyl-4-(3-oxo-1H-isoindol-2-yl)-6-(trifluoromethyl)chromen-3-yl]methyl]-N-methoxyformamide |
|---|---|
| PubChem CID | 19387257 |
| Molecular Formula | C23H21F3N2O4 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-[[2,2-dimethyl-4-(3-oxo-1H-isoindol-2-yl)-6-(trifluoromethyl)chromen-3-yl]methyl]-N-methoxyformamide |
| SMILES | CON(C=O)CC1=C(N2Cc3ccccc3C2=O)c2cc(C(F)(F)F)ccc2OC1(C)C |
| InChI | InChI=1S/C23H21F3N2O4/c1-22(2)18(12-27(13-29)31-3)20(28-11-14-6-4-5-7-16(14)21(28)30)17-10-15(23(24,25)26)8-9-19(17)32-22/h4-10,13H,11-12H2,1-3H3 |
| InChIKey | NLLTUZOYIXNCEN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|