C22H22N4O4S — CID 150903818
1-methyl-3-[2,2,5-trimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]thiourea (PubChem CID 150903818) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is 1-methyl-3-[2,2,5-trimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]thiourea.
| Compound Name | 1-methyl-3-[2,2,5-trimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]thiourea |
|---|---|
| PubChem CID | 150903818 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 1-methyl-3-[2,2,5-trimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]thiourea |
| SMILES | CNC(=S)NC1=C(N2Cc3ccccc3C2=O)c2c(ccc([N+](=O)[O-])c2C)OC1(C)C |
| InChI | InChI=1S/C22H22N4O4S/c1-12-15(26(28)29)9-10-16-17(12)18(19(22(2,3)30-16)24-21(31)23-4)25-11-13-7-5-6-8-14(13)20(25)27/h5-10H,11H2,1-4H3,(H2,23,24,31) |
| InChIKey | LAODIRRJIHDDIT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|