C20H20Cl2N4O2 — CID 19393174
N-[1-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-5-methyl-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide (PubChem CID 19393174) has the molecular formula C20H20Cl2N4O2 and a molecular weight of 419.31 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-5-methyl-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-5-methyl-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 19393174 |
| Molecular Formula | C20H20Cl2N4O2 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-5-methyl-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide |
| SMILES | Cc1cc(NC(=O)c2noc3c2CC(C)CC3)nn1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H20Cl2N4O2/c1-11-3-6-17-14(7-11)19(25-28-17)20(27)23-18-8-12(2)26(24-18)10-13-4-5-15(21)16(22)9-13/h4-5,8-9,11H,3,6-7,10H2,1-2H3,(H,23,24,27) |
| InChIKey | FNWCLCFHNDJYPL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |