C19H16F4N4O2 — CID 19286649
5-methyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide (PubChem CID 19286649) has the molecular formula C19H16F4N4O2 and a molecular weight of 408.36 g/mol. Its IUPAC name is 5-methyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide.
| Compound Name | 5-methyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 19286649 |
| Molecular Formula | C19H16F4N4O2 |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 5-methyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide |
| SMILES | CC1CCc2onc(C(=O)Nc3ccn(Cc4c(F)c(F)cc(F)c4F)n3)c2C1 |
| InChI | InChI=1S/C19H16F4N4O2/c1-9-2-3-14-10(6-9)18(26-29-14)19(28)24-15-4-5-27(25-15)8-11-16(22)12(20)7-13(21)17(11)23/h4-5,7,9H,2-3,6,8H2,1H3,(H,24,25,28) |
| InChIKey | GNMOXOXOBBLYFY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|