C17H12Cl2N4O4 — CID 19398846
(E)-N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(5-nitrofuran-2-yl)prop-2-enamide (PubChem CID 19398846) has the molecular formula C17H12Cl2N4O4 and a molecular weight of 407.21 g/mol. Its IUPAC name is (E)-N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(5-nitrofuran-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(5-nitrofuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 19398846 |
| Molecular Formula | C17H12Cl2N4O4 |
| Molecular Weight | 407.21 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | (E)-N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(5-nitrofuran-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])o1)Nc1ccn(Cc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C17H12Cl2N4O4/c18-13-4-1-11(9-14(13)19)10-22-8-7-15(21-22)20-16(24)5-2-12-3-6-17(27-12)23(25)26/h1-9H,10H2,(H,20,21,24)/b5-2+ |
| InChIKey | KNABEENGXBKCRA-GORDUTHDSA-N |
| XLogP | 4.39 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.21 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|