C17H11Cl2N3O4 — CID 19570867
(E)-1-(3,4-dichlorophenyl)-3-[5-[(3-nitropyrazol-1-yl)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19570867) has the molecular formula C17H11Cl2N3O4 and a molecular weight of 392.20 g/mol. Its IUPAC name is (E)-1-(3,4-dichlorophenyl)-3-[5-[(3-nitropyrazol-1-yl)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dichlorophenyl)-3-[5-[(3-nitropyrazol-1-yl)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19570867 |
| Molecular Formula | C17H11Cl2N3O4 |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | (E)-1-(3,4-dichlorophenyl)-3-[5-[(3-nitropyrazol-1-yl)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cn2ccc([N+](=O)[O-])n2)o1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H11Cl2N3O4/c18-14-5-1-11(9-15(14)19)16(23)6-4-12-2-3-13(26-12)10-21-8-7-17(20-21)22(24)25/h1-9H,10H2/b6-4+ |
| InChIKey | VYOAPHPYPQYWRP-GQCTYLIASA-N |
| XLogP | 4.64 |
| TPSA | 91.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|