C18H14ClN3O6 — CID 19566791
(E)-3-[5-[(4-chloro-3-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one (PubChem CID 19566791) has the molecular formula C18H14ClN3O6 and a molecular weight of 403.78 g/mol. Its IUPAC name is (E)-3-[5-[(4-chloro-3-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(4-chloro-3-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19566791 |
| Molecular Formula | C18H14ClN3O6 |
| Molecular Weight | 403.78 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | (E)-3-[5-[(4-chloro-3-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C(=O)/C=C/c2ccc(Cn3cc(Cl)c([N+](=O)[O-])n3)o2)ccc1O |
| InChI | InChI=1S/C18H14ClN3O6/c1-27-17-8-11(2-6-16(17)24)15(23)7-5-12-3-4-13(28-12)9-21-10-14(19)18(20-21)22(25)26/h2-8,10,24H,9H2,1H3/b7-5+ |
| InChIKey | BKNWBDULTNBGSY-FNORWQNLSA-N |
| XLogP | 3.70 |
| TPSA | 120.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.78 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|