C15H12BrN5O4 — CID 19543295
(E)-3-[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(1-methylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 19543295) has the molecular formula C15H12BrN5O4 and a molecular weight of 406.20 g/mol. Its IUPAC name is (E)-3-[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(1-methylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(1-methylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19543295 |
| Molecular Formula | C15H12BrN5O4 |
| Molecular Weight | 406.20 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | (E)-3-[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(1-methylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | Cn1cc(C(=O)/C=C/c2ccc(Cn3cc(Br)c([N+](=O)[O-])n3)o2)cn1 |
| InChI | InChI=1S/C15H12BrN5O4/c1-19-7-10(6-17-19)14(22)5-4-11-2-3-12(25-11)8-20-9-13(16)15(18-20)21(23)24/h2-7,9H,8H2,1H3/b5-4+ |
| InChIKey | DPSLETAGCRJYNW-SNAWJCMRSA-N |
| XLogP | 2.82 |
| TPSA | 108.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|