C18H12BrN3O6 — CID 19568992
(E)-1-(1,3-benzodioxol-5-yl)-3-[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19568992) has the molecular formula C18H12BrN3O6 and a molecular weight of 446.21 g/mol. Its IUPAC name is (E)-1-(1,3-benzodioxol-5-yl)-3-[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(1,3-benzodioxol-5-yl)-3-[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19568992 |
| Molecular Formula | C18H12BrN3O6 |
| Molecular Weight | 446.21 g/mol |
| Exact Mass | 444.99 |
| IUPAC Name | (E)-1-(1,3-benzodioxol-5-yl)-3-[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cn2cc(Br)c([N+](=O)[O-])n2)o1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H12BrN3O6/c19-14-9-21(20-18(14)22(24)25)8-13-3-2-12(28-13)4-5-15(23)11-1-6-16-17(7-11)27-10-26-16/h1-7,9H,8,10H2/b5-4+ |
| InChIKey | IDTFWPFXDGICBJ-SNAWJCMRSA-N |
| XLogP | 3.82 |
| TPSA | 109.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.21 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|