C21H19ClN4O5 — CID 19541534
(E)-3-[5-[(4-chloro-3-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one (PubChem CID 19541534) has the molecular formula C21H19ClN4O5 and a molecular weight of 442.86 g/mol. Its IUPAC name is (E)-3-[5-[(4-chloro-3-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(4-chloro-3-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19541534 |
| Molecular Formula | C21H19ClN4O5 |
| Molecular Weight | 442.86 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | (E)-3-[5-[(4-chloro-3-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cn2cc(Cl)c([N+](=O)[O-])n2)o1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H19ClN4O5/c22-19-14-25(23-21(19)26(28)29)13-18-6-5-17(31-18)7-8-20(27)15-1-3-16(4-2-15)24-9-11-30-12-10-24/h1-8,14H,9-13H2/b8-7+ |
| InChIKey | QSUOFMAOOVSSIS-BQYQJAHWSA-N |
| XLogP | 3.82 |
| TPSA | 103.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.86 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|