C19H16ClN3O6 — CID 19568796
(E)-3-[5-[(4-chloro-3-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(2,5-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 19568796) has the molecular formula C19H16ClN3O6 and a molecular weight of 417.81 g/mol. Its IUPAC name is (E)-3-[5-[(4-chloro-3-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(2,5-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(4-chloro-3-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(2,5-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19568796 |
| Molecular Formula | C19H16ClN3O6 |
| Molecular Weight | 417.81 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | (E)-3-[5-[(4-chloro-3-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(2,5-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(OC)c(C(=O)/C=C/c2ccc(Cn3cc(Cl)c([N+](=O)[O-])n3)o2)c1 |
| InChI | InChI=1S/C19H16ClN3O6/c1-27-13-6-8-18(28-2)15(9-13)17(24)7-5-12-3-4-14(29-12)10-22-11-16(20)19(21-22)23(25)26/h3-9,11H,10H2,1-2H3/b7-5+ |
| InChIKey | HXASOXZVPAZXNN-FNORWQNLSA-N |
| XLogP | 4.00 |
| TPSA | 109.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.81 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|