C25H20F4N4O4 — CID 19400289
1-ethyl-N-(furan-2-ylmethyl)-4-[[4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzoyl]amino]pyrazole-3-carboxamide (PubChem CID 19400289) has the molecular formula C25H20F4N4O4 and a molecular weight of 516.45 g/mol. Its IUPAC name is 1-ethyl-N-(furan-2-ylmethyl)-4-[[4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzoyl]amino]pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-N-(furan-2-ylmethyl)-4-[[4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzoyl]amino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19400289 |
| Molecular Formula | C25H20F4N4O4 |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 1-ethyl-N-(furan-2-ylmethyl)-4-[[4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzoyl]amino]pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)c2ccc(COc3c(F)c(F)cc(F)c3F)cc2)c(C(=O)NCc2ccco2)n1 |
| InChI | InChI=1S/C25H20F4N4O4/c1-2-33-12-19(22(32-33)25(35)30-11-16-4-3-9-36-16)31-24(34)15-7-5-14(6-8-15)13-37-23-20(28)17(26)10-18(27)21(23)29/h3-10,12H,2,11,13H2,1H3,(H,30,35)(H,31,34) |
| InChIKey | SPFNECVNGYYZAP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|