C26H27FN4O3 — CID 19404201
6-(1,3-dioxoisoindol-2-yl)-N-[1-[(3-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]hexanamide (PubChem CID 19404201) has the molecular formula C26H27FN4O3 and a molecular weight of 462.53 g/mol. Its IUPAC name is 6-(1,3-dioxoisoindol-2-yl)-N-[1-[(3-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]hexanamide.
| Compound Name | 6-(1,3-dioxoisoindol-2-yl)-N-[1-[(3-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]hexanamide |
|---|---|
| PubChem CID | 19404201 |
| Molecular Formula | C26H27FN4O3 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 6-(1,3-dioxoisoindol-2-yl)-N-[1-[(3-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]hexanamide |
| SMILES | Cc1nn(Cc2cccc(F)c2)c(C)c1NC(=O)CCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H27FN4O3/c1-17-24(18(2)31(29-17)16-19-9-8-10-20(27)15-19)28-23(32)13-4-3-7-14-30-25(33)21-11-5-6-12-22(21)26(30)34/h5-6,8-12,15H,3-4,7,13-14,16H2,1-2H3,(H,28,32) |
| InChIKey | GPAKCTRUQZIORJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|