C19H16ClF3N4O — CID 19407539
1-[1-[(2-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 19407539) has the molecular formula C19H16ClF3N4O and a molecular weight of 408.81 g/mol. Its IUPAC name is 1-[1-[(2-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[1-[(2-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 19407539 |
| Molecular Formula | C19H16ClF3N4O |
| Molecular Weight | 408.81 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 1-[1-[(2-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1cc(NC(=O)Nc2cccc(C(F)(F)F)c2)nn1Cc1ccccc1Cl |
| InChI | InChI=1S/C19H16ClF3N4O/c1-12-9-17(26-27(12)11-13-5-2-3-8-16(13)20)25-18(28)24-15-7-4-6-14(10-15)19(21,22)23/h2-10H,11H2,1H3,(H2,24,25,26,28) |
| InChIKey | ORYOQOLGAXRXEG-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.81 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |