C22H22Cl3NO3 — CID 19415522
N-(2-adamantyl)-5-[(2,4,6-trichlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19415522) has the molecular formula C22H22Cl3NO3 and a molecular weight of 454.78 g/mol. Its IUPAC name is N-(2-adamantyl)-5-[(2,4,6-trichlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(2-adamantyl)-5-[(2,4,6-trichlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19415522 |
| Molecular Formula | C22H22Cl3NO3 |
| Molecular Weight | 454.78 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-(2-adamantyl)-5-[(2,4,6-trichlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(NC1C2CC3CC(C2)CC1C3)c1ccc(COc2c(Cl)cc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C22H22Cl3NO3/c23-15-8-17(24)21(18(25)9-15)28-10-16-1-2-19(29-16)22(27)26-20-13-4-11-3-12(6-13)7-14(20)5-11/h1-2,8-9,11-14,20H,3-7,10H2,(H,26,27) |
| InChIKey | LEDLSZXIFIAPHQ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.78 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |