C23H24Cl3NO3 — CID 19415569
N-(1-adamantylmethyl)-5-[(2,4,6-trichlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19415569) has the molecular formula C23H24Cl3NO3 and a molecular weight of 468.81 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-5-[(2,4,6-trichlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(1-adamantylmethyl)-5-[(2,4,6-trichlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19415569 |
| Molecular Formula | C23H24Cl3NO3 |
| Molecular Weight | 468.81 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | N-(1-adamantylmethyl)-5-[(2,4,6-trichlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)c1ccc(COc2c(Cl)cc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C23H24Cl3NO3/c24-16-6-18(25)21(19(26)7-16)29-11-17-1-2-20(30-17)22(28)27-12-23-8-13-3-14(9-23)5-15(4-13)10-23/h1-2,6-7,13-15H,3-5,8-12H2,(H,27,28) |
| InChIKey | JVNWBFCDNBYNQM-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.81 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |